C21H32ClN7 — CID 111995821
1-[2-(4-chlorophenyl)-2-(dimethylamino)ethyl]-2-methyl-3-[1-(1-methylpyrazol-4-yl)piperidin-3-yl]guanidine (PubChem CID 111995821) has the molecular formula C21H32ClN7 and a molecular weight of 417.99 g/mol. Its IUPAC name is 1-[2-(4-chlorophenyl)-2-(dimethylamino)ethyl]-2-methyl-3-[1-(1-methylpyrazol-4-yl)piperidin-3-yl]guanidine.
| Compound Name | 1-[2-(4-chlorophenyl)-2-(dimethylamino)ethyl]-2-methyl-3-[1-(1-methylpyrazol-4-yl)piperidin-3-yl]guanidine |
|---|---|
| PubChem CID | 111995821 |
| Molecular Formula | C21H32ClN7 |
| Molecular Weight | 417.99 g/mol |
| Exact Mass | 417.24 |
| IUPAC Name | 1-[2-(4-chlorophenyl)-2-(dimethylamino)ethyl]-2-methyl-3-[1-(1-methylpyrazol-4-yl)piperidin-3-yl]guanidine |
| SMILES | C/N=C(\NCC(c1ccc(Cl)cc1)N(C)C)NC1CCCN(c2cnn(C)c2)C1 |
| InChI | InChI=1S/C21H32ClN7/c1-23-21(24-13-20(27(2)3)16-7-9-17(22)10-8-16)26-18-6-5-11-29(14-18)19-12-25-28(4)15-19/h7-10,12,15,18,20H,5-6,11,13-14H2,1-4H3,(H2,23,24,26) |
| InChIKey | BPRZRIHWUJFBFO-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 60.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.99 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|