C19H31N7S — CID 119159867
2-methyl-1-[(5-methyl-4-propan-2-yl-1,3-thiazol-2-yl)methyl]-3-[1-(1-methylpyrazol-4-yl)piperidin-3-yl]guanidine (PubChem CID 119159867) has the molecular formula C19H31N7S and a molecular weight of 389.57 g/mol. Its IUPAC name is 2-methyl-1-[(5-methyl-4-propan-2-yl-1,3-thiazol-2-yl)methyl]-3-[1-(1-methylpyrazol-4-yl)piperidin-3-yl]guanidine.
| Compound Name | 2-methyl-1-[(5-methyl-4-propan-2-yl-1,3-thiazol-2-yl)methyl]-3-[1-(1-methylpyrazol-4-yl)piperidin-3-yl]guanidine |
|---|---|
| PubChem CID | 119159867 |
| Molecular Formula | C19H31N7S |
| Molecular Weight | 389.57 g/mol |
| Exact Mass | 389.24 |
| IUPAC Name | 2-methyl-1-[(5-methyl-4-propan-2-yl-1,3-thiazol-2-yl)methyl]-3-[1-(1-methylpyrazol-4-yl)piperidin-3-yl]guanidine |
| SMILES | C/N=C(\NCc1nc(C(C)C)c(C)s1)NC1CCCN(c2cnn(C)c2)C1 |
| InChI | InChI=1S/C19H31N7S/c1-13(2)18-14(3)27-17(24-18)10-21-19(20-4)23-15-7-6-8-26(11-15)16-9-22-25(5)12-16/h9,12-13,15H,6-8,10-11H2,1-5H3,(H2,20,21,23) |
| InChIKey | KOPACSCHBZUHQI-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 70.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.57 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|