C19H31N7S — CID 119159782
2-methyl-1-[(5-methyl-4-propan-2-yl-1,3-thiazol-2-yl)methyl]-3-(3-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)guanidine (PubChem CID 119159782) has the molecular formula C19H31N7S and a molecular weight of 389.57 g/mol. Its IUPAC name is 2-methyl-1-[(5-methyl-4-propan-2-yl-1,3-thiazol-2-yl)methyl]-3-(3-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)guanidine.
| Compound Name | 2-methyl-1-[(5-methyl-4-propan-2-yl-1,3-thiazol-2-yl)methyl]-3-(3-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)guanidine |
|---|---|
| PubChem CID | 119159782 |
| Molecular Formula | C19H31N7S |
| Molecular Weight | 389.57 g/mol |
| Exact Mass | 389.24 |
| IUPAC Name | 2-methyl-1-[(5-methyl-4-propan-2-yl-1,3-thiazol-2-yl)methyl]-3-(3-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)guanidine |
| SMILES | C/N=C(\NCc1nc(C(C)C)c(C)s1)NC1CCc2nnc(C(C)C)n2C1 |
| InChI | InChI=1S/C19H31N7S/c1-11(2)17-13(5)27-16(23-17)9-21-19(20-6)22-14-7-8-15-24-25-18(12(3)4)26(15)10-14/h11-12,14H,7-10H2,1-6H3,(H2,20,21,22) |
| InChIKey | BZAAOJQBGZBOKW-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 80.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.57 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|