C18H30N8 — CID 119153912
2-methyl-1-(3-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine (PubChem CID 119153912) has the molecular formula C18H30N8 and a molecular weight of 358.49 g/mol. Its IUPAC name is 2-methyl-1-(3-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine.
| Compound Name | 2-methyl-1-(3-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine |
|---|---|
| PubChem CID | 119153912 |
| Molecular Formula | C18H30N8 |
| Molecular Weight | 358.49 g/mol |
| Exact Mass | 358.26 |
| IUPAC Name | 2-methyl-1-(3-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine |
| SMILES | C/N=C(\NCc1c(C)nn(C)c1C)NC1CCc2nnc(C(C)C)n2C1 |
| InChI | InChI=1S/C18H30N8/c1-11(2)17-23-22-16-8-7-14(10-26(16)17)21-18(19-5)20-9-15-12(3)24-25(6)13(15)4/h11,14H,7-10H2,1-6H3,(H2,19,20,21) |
| InChIKey | IDZSBOYEWHQEQW-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 84.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.49 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|