C19H34N6O — CID 119162310
1-(3-methoxy-2,2,3-trimethylcyclobutyl)-2-methyl-3-(3-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)guanidine (PubChem CID 119162310) has the molecular formula C19H34N6O and a molecular weight of 362.52 g/mol. Its IUPAC name is 1-(3-methoxy-2,2,3-trimethylcyclobutyl)-2-methyl-3-(3-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)guanidine.
| Compound Name | 1-(3-methoxy-2,2,3-trimethylcyclobutyl)-2-methyl-3-(3-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)guanidine |
|---|---|
| PubChem CID | 119162310 |
| Molecular Formula | C19H34N6O |
| Molecular Weight | 362.52 g/mol |
| Exact Mass | 362.28 |
| IUPAC Name | 1-(3-methoxy-2,2,3-trimethylcyclobutyl)-2-methyl-3-(3-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)guanidine |
| SMILES | C/N=C(/NC1CCc2nnc(C(C)C)n2C1)NC1CC(C)(OC)C1(C)C |
| InChI | InChI=1S/C19H34N6O/c1-12(2)16-24-23-15-9-8-13(11-25(15)16)21-17(20-6)22-14-10-19(5,26-7)18(14,3)4/h12-14H,8-11H2,1-7H3,(H2,20,21,22) |
| InChIKey | JESWESZLFRSAPF-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.52 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|