C14H24IN5OS — CID 119160705
1-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-2-methyl-3-(1-methyl-6-oxopiperidin-3-yl)guanidine;hydroiodide (PubChem CID 119160705) has the molecular formula C14H24IN5OS and a molecular weight of 437.35 g/mol. Its IUPAC name is 1-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-2-methyl-3-(1-methyl-6-oxopiperidin-3-yl)guanidine;hydroiodide.
| Compound Name | 1-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-2-methyl-3-(1-methyl-6-oxopiperidin-3-yl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 119160705 |
| Molecular Formula | C14H24IN5OS |
| Molecular Weight | 437.35 g/mol |
| Exact Mass | 437.07 |
| IUPAC Name | 1-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-2-methyl-3-(1-methyl-6-oxopiperidin-3-yl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1nc(C)c(C)s1)NC1CCC(=O)N(C)C1.I |
| InChI | InChI=1S/C14H23N5OS.HI/c1-9-10(2)21-12(17-9)7-16-14(15-3)18-11-5-6-13(20)19(4)8-11;/h11H,5-8H2,1-4H3,(H2,15,16,18);1H |
| InChIKey | ZMRVLBBWFNVITJ-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.35 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|