C17H21Cl2IN4O2S — CID 111197571
1-[(2,4-dichlorophenyl)methyl]-3-[[2-(methanesulfonamido)phenyl]methyl]-2-methylguanidine;hydroiodide (PubChem CID 111197571) has the molecular formula C17H21Cl2IN4O2S and a molecular weight of 543.26 g/mol. Its IUPAC name is 1-[(2,4-dichlorophenyl)methyl]-3-[[2-(methanesulfonamido)phenyl]methyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[(2,4-dichlorophenyl)methyl]-3-[[2-(methanesulfonamido)phenyl]methyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111197571 |
| Molecular Formula | C17H21Cl2IN4O2S |
| Molecular Weight | 543.26 g/mol |
| Exact Mass | 541.98 |
| IUPAC Name | 1-[(2,4-dichlorophenyl)methyl]-3-[[2-(methanesulfonamido)phenyl]methyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCc1ccc(Cl)cc1Cl)NCc1ccccc1NS(C)(=O)=O.I |
| InChI | InChI=1S/C17H20Cl2N4O2S.HI/c1-20-17(21-10-12-7-8-14(18)9-15(12)19)22-11-13-5-3-4-6-16(13)23-26(2,24)25;/h3-9,23H,10-11H2,1-2H3,(H2,20,21,22);1H |
| InChIKey | VBTNSFHWHRAIJZ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 82.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.26 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|