C14H24N4O2S — CID 75364847
1-[[2-(methanesulfonamido)phenyl]methyl]-2-methyl-3-(2-methylpropyl)guanidine (PubChem CID 75364847) has the molecular formula C14H24N4O2S and a molecular weight of 312.44 g/mol. Its IUPAC name is 1-[[2-(methanesulfonamido)phenyl]methyl]-2-methyl-3-(2-methylpropyl)guanidine.
| Compound Name | 1-[[2-(methanesulfonamido)phenyl]methyl]-2-methyl-3-(2-methylpropyl)guanidine |
|---|---|
| PubChem CID | 75364847 |
| Molecular Formula | C14H24N4O2S |
| Molecular Weight | 312.44 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 1-[[2-(methanesulfonamido)phenyl]methyl]-2-methyl-3-(2-methylpropyl)guanidine |
| SMILES | C/N=C(/NCc1ccccc1NS(C)(=O)=O)NCC(C)C |
| InChI | InChI=1S/C14H24N4O2S/c1-11(2)9-16-14(15-3)17-10-12-7-5-6-8-13(12)18-21(4,19)20/h5-8,11,18H,9-10H2,1-4H3,(H2,15,16,17) |
| InChIKey | BUDAFKRFMBWIQY-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 82.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.44 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|