C18H24FN5O2 — CID 109430839
2-[[[N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-N'-methylcarbamimidoyl]amino]methyl]-3-(4-fluorophenyl)propanamide (PubChem CID 109430839) has the molecular formula C18H24FN5O2 and a molecular weight of 361.42 g/mol. Its IUPAC name is 2-[[[N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-N'-methylcarbamimidoyl]amino]methyl]-3-(4-fluorophenyl)propanamide.
| Compound Name | 2-[[[N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-N'-methylcarbamimidoyl]amino]methyl]-3-(4-fluorophenyl)propanamide |
|---|---|
| PubChem CID | 109430839 |
| Molecular Formula | C18H24FN5O2 |
| Molecular Weight | 361.42 g/mol |
| Exact Mass | 361.19 |
| IUPAC Name | 2-[[[N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-N'-methylcarbamimidoyl]amino]methyl]-3-(4-fluorophenyl)propanamide |
| SMILES | C/N=C(\NCc1nc(C)c(C)o1)NCC(Cc1ccc(F)cc1)C(N)=O |
| InChI | InChI=1S/C18H24FN5O2/c1-11-12(2)26-16(24-11)10-23-18(21-3)22-9-14(17(20)25)8-13-4-6-15(19)7-5-13/h4-7,14H,8-10H2,1-3H3,(H2,20,25)(H2,21,22,23) |
| InChIKey | YOGALZKPVZAZHS-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 105.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.42 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|