C21H28FIN4O — CID 111937836
2-[[[N-[(2,4-dimethylphenyl)methyl]-N'-methylcarbamimidoyl]amino]methyl]-3-(4-fluorophenyl)propanamide;hydroiodide (PubChem CID 111937836) has the molecular formula C21H28FIN4O and a molecular weight of 498.38 g/mol. Its IUPAC name is 2-[[[N-[(2,4-dimethylphenyl)methyl]-N'-methylcarbamimidoyl]amino]methyl]-3-(4-fluorophenyl)propanamide;hydroiodide.
| Compound Name | 2-[[[N-[(2,4-dimethylphenyl)methyl]-N'-methylcarbamimidoyl]amino]methyl]-3-(4-fluorophenyl)propanamide;hydroiodide |
|---|---|
| PubChem CID | 111937836 |
| Molecular Formula | C21H28FIN4O |
| Molecular Weight | 498.38 g/mol |
| Exact Mass | 498.13 |
| IUPAC Name | 2-[[[N-[(2,4-dimethylphenyl)methyl]-N'-methylcarbamimidoyl]amino]methyl]-3-(4-fluorophenyl)propanamide;hydroiodide |
| SMILES | C/N=C(/NCc1ccc(C)cc1C)NCC(Cc1ccc(F)cc1)C(N)=O.I |
| InChI | InChI=1S/C21H27FN4O.HI/c1-14-4-7-17(15(2)10-14)12-25-21(24-3)26-13-18(20(23)27)11-16-5-8-19(22)9-6-16;/h4-10,18H,11-13H2,1-3H3,(H2,23,27)(H2,24,25,26);1H |
| InChIKey | DTWUHOUBAVVWER-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.38 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|