C17H19F4N5OS — CID 111615703
2-[(4-fluorophenyl)methyl]-3-[[N'-methyl-N-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]carbamimidoyl]amino]propanamide (PubChem CID 111615703) has the molecular formula C17H19F4N5OS and a molecular weight of 417.43 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)methyl]-3-[[N'-methyl-N-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]carbamimidoyl]amino]propanamide.
| Compound Name | 2-[(4-fluorophenyl)methyl]-3-[[N'-methyl-N-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]carbamimidoyl]amino]propanamide |
|---|---|
| PubChem CID | 111615703 |
| Molecular Formula | C17H19F4N5OS |
| Molecular Weight | 417.43 g/mol |
| Exact Mass | 417.12 |
| IUPAC Name | 2-[(4-fluorophenyl)methyl]-3-[[N'-methyl-N-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]carbamimidoyl]amino]propanamide |
| SMILES | C/N=C(\NCc1nc(C(F)(F)F)cs1)NCC(Cc1ccc(F)cc1)C(N)=O |
| InChI | InChI=1S/C17H19F4N5OS/c1-23-16(25-8-14-26-13(9-28-14)17(19,20)21)24-7-11(15(22)27)6-10-2-4-12(18)5-3-10/h2-5,9,11H,6-8H2,1H3,(H2,22,27)(H2,23,24,25) |
| InChIKey | BTXBIKCYLISNBI-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 92.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.43 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|