C15H19F3IN5O2S2 — CID 111615203
2-methyl-1-[[4-(methylsulfamoyl)phenyl]methyl]-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine;hydroiodide (PubChem CID 111615203) has the molecular formula C15H19F3IN5O2S2 and a molecular weight of 549.38 g/mol. Its IUPAC name is 2-methyl-1-[[4-(methylsulfamoyl)phenyl]methyl]-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[[4-(methylsulfamoyl)phenyl]methyl]-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111615203 |
| Molecular Formula | C15H19F3IN5O2S2 |
| Molecular Weight | 549.38 g/mol |
| Exact Mass | 549.00 |
| IUPAC Name | 2-methyl-1-[[4-(methylsulfamoyl)phenyl]methyl]-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1ccc(S(=O)(=O)NC)cc1)NCc1nc(C(F)(F)F)cs1.I |
| InChI | InChI=1S/C15H18F3N5O2S2.HI/c1-19-14(22-8-13-23-12(9-26-13)15(16,17)18)21-7-10-3-5-11(6-4-10)27(24,25)20-2;/h3-6,9,20H,7-8H2,1-2H3,(H2,19,21,22);1H |
| InChIKey | DPWCBKGAGZJMCD-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 95.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.38 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|