C17H22F3N5OS — CID 111617685
1-[[4-(2-methoxyethylamino)phenyl]methyl]-2-methyl-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine (PubChem CID 111617685) has the molecular formula C17H22F3N5OS and a molecular weight of 401.46 g/mol. Its IUPAC name is 1-[[4-(2-methoxyethylamino)phenyl]methyl]-2-methyl-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine.
| Compound Name | 1-[[4-(2-methoxyethylamino)phenyl]methyl]-2-methyl-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine |
|---|---|
| PubChem CID | 111617685 |
| Molecular Formula | C17H22F3N5OS |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.15 |
| IUPAC Name | 1-[[4-(2-methoxyethylamino)phenyl]methyl]-2-methyl-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine |
| SMILES | C/N=C(/NCc1ccc(NCCOC)cc1)NCc1nc(C(F)(F)F)cs1 |
| InChI | InChI=1S/C17H22F3N5OS/c1-21-16(24-10-15-25-14(11-27-15)17(18,19)20)23-9-12-3-5-13(6-4-12)22-7-8-26-2/h3-6,11,22H,7-10H2,1-2H3,(H2,21,23,24) |
| InChIKey | IHNTUOLNINPSNW-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 70.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|