C23H31FIN5O — CID 111411222
N-(4-fluorophenyl)-2-[[N'-methyl-N-[[4-(piperidin-1-ylmethyl)phenyl]methyl]carbamimidoyl]amino]acetamide;hydroiodide (PubChem CID 111411222) has the molecular formula C23H31FIN5O and a molecular weight of 539.44 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2-[[N'-methyl-N-[[4-(piperidin-1-ylmethyl)phenyl]methyl]carbamimidoyl]amino]acetamide;hydroiodide.
| Compound Name | N-(4-fluorophenyl)-2-[[N'-methyl-N-[[4-(piperidin-1-ylmethyl)phenyl]methyl]carbamimidoyl]amino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111411222 |
| Molecular Formula | C23H31FIN5O |
| Molecular Weight | 539.44 g/mol |
| Exact Mass | 539.16 |
| IUPAC Name | N-(4-fluorophenyl)-2-[[N'-methyl-N-[[4-(piperidin-1-ylmethyl)phenyl]methyl]carbamimidoyl]amino]acetamide;hydroiodide |
| SMILES | C/N=C(\NCC(=O)Nc1ccc(F)cc1)NCc1ccc(CN2CCCCC2)cc1.I |
| InChI | InChI=1S/C23H30FN5O.HI/c1-25-23(27-16-22(30)28-21-11-9-20(24)10-12-21)26-15-18-5-7-19(8-6-18)17-29-13-3-2-4-14-29;/h5-12H,2-4,13-17H2,1H3,(H,28,30)(H2,25,26,27);1H |
| InChIKey | XTRCTQDRHQSJQX-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.44 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|