C20H23F4IN4O2 — CID 111858024
N-(4-fluorophenyl)-2-[[N'-methyl-N-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]carbamimidoyl]amino]acetamide;hydroiodide (PubChem CID 111858024) has the molecular formula C20H23F4IN4O2 and a molecular weight of 554.33 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2-[[N'-methyl-N-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]carbamimidoyl]amino]acetamide;hydroiodide.
| Compound Name | N-(4-fluorophenyl)-2-[[N'-methyl-N-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]carbamimidoyl]amino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111858024 |
| Molecular Formula | C20H23F4IN4O2 |
| Molecular Weight | 554.33 g/mol |
| Exact Mass | 554.08 |
| IUPAC Name | N-(4-fluorophenyl)-2-[[N'-methyl-N-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]carbamimidoyl]amino]acetamide;hydroiodide |
| SMILES | C/N=C(\NCC(=O)Nc1ccc(F)cc1)NCc1ccc(COCC(F)(F)F)cc1.I |
| InChI | InChI=1S/C20H22F4N4O2.HI/c1-25-19(27-11-18(29)28-17-8-6-16(21)7-9-17)26-10-14-2-4-15(5-3-14)12-30-13-20(22,23)24;/h2-9H,10-13H2,1H3,(H,28,29)(H2,25,26,27);1H |
| InChIKey | UICXOQQLPUHDMQ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.33 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|