C22H28F3IN4O2 — CID 111857756
2-[[N'-methyl-N-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]carbamimidoyl]amino]-N-(2-phenylethyl)acetamide;hydroiodide (PubChem CID 111857756) has the molecular formula C22H28F3IN4O2 and a molecular weight of 564.39 g/mol. Its IUPAC name is 2-[[N'-methyl-N-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]carbamimidoyl]amino]-N-(2-phenylethyl)acetamide;hydroiodide.
| Compound Name | 2-[[N'-methyl-N-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]carbamimidoyl]amino]-N-(2-phenylethyl)acetamide;hydroiodide |
|---|---|
| PubChem CID | 111857756 |
| Molecular Formula | C22H28F3IN4O2 |
| Molecular Weight | 564.39 g/mol |
| Exact Mass | 564.12 |
| IUPAC Name | 2-[[N'-methyl-N-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]carbamimidoyl]amino]-N-(2-phenylethyl)acetamide;hydroiodide |
| SMILES | C/N=C(\NCC(=O)NCCc1ccccc1)NCc1ccc(COCC(F)(F)F)cc1.I |
| InChI | InChI=1S/C22H27F3N4O2.HI/c1-26-21(29-14-20(30)27-12-11-17-5-3-2-4-6-17)28-13-18-7-9-19(10-8-18)15-31-16-22(23,24)25;/h2-10H,11-16H2,1H3,(H,27,30)(H2,26,28,29);1H |
| InChIKey | KGADODKLVRFFIV-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.39 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|