C20H23F4IN4O — CID 111889954
2-[[N-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-N'-methylcarbamimidoyl]amino]-N-(2-phenylethyl)acetamide;hydroiodide (PubChem CID 111889954) has the molecular formula C20H23F4IN4O and a molecular weight of 538.33 g/mol. Its IUPAC name is 2-[[N-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-N'-methylcarbamimidoyl]amino]-N-(2-phenylethyl)acetamide;hydroiodide.
| Compound Name | 2-[[N-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-N'-methylcarbamimidoyl]amino]-N-(2-phenylethyl)acetamide;hydroiodide |
|---|---|
| PubChem CID | 111889954 |
| Molecular Formula | C20H23F4IN4O |
| Molecular Weight | 538.33 g/mol |
| Exact Mass | 538.09 |
| IUPAC Name | 2-[[N-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-N'-methylcarbamimidoyl]amino]-N-(2-phenylethyl)acetamide;hydroiodide |
| SMILES | C/N=C(\NCC(=O)NCCc1ccccc1)NCc1ccc(F)cc1C(F)(F)F.I |
| InChI | InChI=1S/C20H22F4N4O.HI/c1-25-19(27-12-15-7-8-16(21)11-17(15)20(22,23)24)28-13-18(29)26-10-9-14-5-3-2-4-6-14;/h2-8,11H,9-10,12-13H2,1H3,(H,26,29)(H2,25,27,28);1H |
| InChIKey | RFAVQCFAGOOMEN-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.33 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|