C21H22F4IN5 — CID 111889686
1-[(1-benzylpyrazol-4-yl)methyl]-3-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-2-methylguanidine;hydroiodide (PubChem CID 111889686) has the molecular formula C21H22F4IN5 and a molecular weight of 547.34 g/mol. Its IUPAC name is 1-[(1-benzylpyrazol-4-yl)methyl]-3-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[(1-benzylpyrazol-4-yl)methyl]-3-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111889686 |
| Molecular Formula | C21H22F4IN5 |
| Molecular Weight | 547.34 g/mol |
| Exact Mass | 547.09 |
| IUPAC Name | 1-[(1-benzylpyrazol-4-yl)methyl]-3-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCc1cnn(Cc2ccccc2)c1)NCc1ccc(F)cc1C(F)(F)F.I |
| InChI | InChI=1S/C21H21F4N5.HI/c1-26-20(28-12-17-7-8-18(22)9-19(17)21(23,24)25)27-10-16-11-29-30(14-16)13-15-5-3-2-4-6-15;/h2-9,11,14H,10,12-13H2,1H3,(H2,26,27,28);1H |
| InChIKey | VZGZUJPPPNMHOS-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 54.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.34 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|