C22H26FN5O — CID 111678084
1-[(1-benzylpyrazol-4-yl)methyl]-3-[2-(4-fluorophenoxy)propyl]-2-methylguanidine (PubChem CID 111678084) has the molecular formula C22H26FN5O and a molecular weight of 395.48 g/mol. Its IUPAC name is 1-[(1-benzylpyrazol-4-yl)methyl]-3-[2-(4-fluorophenoxy)propyl]-2-methylguanidine.
| Compound Name | 1-[(1-benzylpyrazol-4-yl)methyl]-3-[2-(4-fluorophenoxy)propyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111678084 |
| Molecular Formula | C22H26FN5O |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | 1-[(1-benzylpyrazol-4-yl)methyl]-3-[2-(4-fluorophenoxy)propyl]-2-methylguanidine |
| SMILES | C/N=C(\NCc1cnn(Cc2ccccc2)c1)NCC(C)Oc1ccc(F)cc1 |
| InChI | InChI=1S/C22H26FN5O/c1-17(29-21-10-8-20(23)9-11-21)12-25-22(24-2)26-13-19-14-27-28(16-19)15-18-6-4-3-5-7-18/h3-11,14,16-17H,12-13,15H2,1-2H3,(H2,24,25,26) |
| InChIKey | KLLCLNAWFLTKGV-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 63.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|