C16H23ClIN5O — CID 75468254
1-[2-(4-chlorophenoxy)propyl]-2-methyl-3-[(1-methylpyrazol-4-yl)methyl]guanidine;hydroiodide (PubChem CID 75468254) has the molecular formula C16H23ClIN5O and a molecular weight of 463.75 g/mol. Its IUPAC name is 1-[2-(4-chlorophenoxy)propyl]-2-methyl-3-[(1-methylpyrazol-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(4-chlorophenoxy)propyl]-2-methyl-3-[(1-methylpyrazol-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 75468254 |
| Molecular Formula | C16H23ClIN5O |
| Molecular Weight | 463.75 g/mol |
| Exact Mass | 463.06 |
| IUPAC Name | 1-[2-(4-chlorophenoxy)propyl]-2-methyl-3-[(1-methylpyrazol-4-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1cnn(C)c1)NCC(C)Oc1ccc(Cl)cc1.I |
| InChI | InChI=1S/C16H22ClN5O.HI/c1-12(23-15-6-4-14(17)5-7-15)8-19-16(18-2)20-9-13-10-21-22(3)11-13;/h4-7,10-12H,8-9H2,1-3H3,(H2,18,19,20);1H |
| InChIKey | XREUANLSZRZTLS-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 63.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.75 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|