C22H28ClIN6O — CID 111680775
1-[2-(4-chlorophenoxy)propyl]-3-[[6-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]methyl]-2-methylguanidine;hydroiodide (PubChem CID 111680775) has the molecular formula C22H28ClIN6O and a molecular weight of 554.86 g/mol. Its IUPAC name is 1-[2-(4-chlorophenoxy)propyl]-3-[[6-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]methyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[2-(4-chlorophenoxy)propyl]-3-[[6-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]methyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111680775 |
| Molecular Formula | C22H28ClIN6O |
| Molecular Weight | 554.86 g/mol |
| Exact Mass | 554.11 |
| IUPAC Name | 1-[2-(4-chlorophenoxy)propyl]-3-[[6-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]methyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(/NCc1ccc(-n2nc(C)cc2C)nc1)NCC(C)Oc1ccc(Cl)cc1.I |
| InChI | InChI=1S/C22H27ClN6O.HI/c1-15-11-16(2)29(28-15)21-10-5-18(13-25-21)14-27-22(24-4)26-12-17(3)30-20-8-6-19(23)7-9-20;/h5-11,13,17H,12,14H2,1-4H3,(H2,24,26,27);1H |
| InChIKey | YDPNKXSKTONXSU-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.86 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|