C21H26FIN6 — CID 111853295
1-[[6-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]methyl]-3-[(4-fluoro-3-methylphenyl)methyl]-2-methylguanidine;hydroiodide (PubChem CID 111853295) has the molecular formula C21H26FIN6 and a molecular weight of 508.38 g/mol. Its IUPAC name is 1-[[6-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]methyl]-3-[(4-fluoro-3-methylphenyl)methyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[[6-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]methyl]-3-[(4-fluoro-3-methylphenyl)methyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111853295 |
| Molecular Formula | C21H26FIN6 |
| Molecular Weight | 508.38 g/mol |
| Exact Mass | 508.12 |
| IUPAC Name | 1-[[6-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]methyl]-3-[(4-fluoro-3-methylphenyl)methyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(/NCc1ccc(-n2nc(C)cc2C)nc1)NCc1ccc(F)c(C)c1.I |
| InChI | InChI=1S/C21H25FN6.HI/c1-14-9-17(5-7-19(14)22)11-25-21(23-4)26-13-18-6-8-20(24-12-18)28-16(3)10-15(2)27-28;/h5-10,12H,11,13H2,1-4H3,(H2,23,25,26);1H |
| InChIKey | WBMGZDLCTNYEJC-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.38 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|