C19H22F4IN3O — CID 109410834
1-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-3-(3-hydroxy-2-phenylpropyl)-2-methylguanidine;hydroiodide (PubChem CID 109410834) has the molecular formula C19H22F4IN3O and a molecular weight of 511.30 g/mol. Its IUPAC name is 1-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-3-(3-hydroxy-2-phenylpropyl)-2-methylguanidine;hydroiodide.
| Compound Name | 1-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-3-(3-hydroxy-2-phenylpropyl)-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109410834 |
| Molecular Formula | C19H22F4IN3O |
| Molecular Weight | 511.30 g/mol |
| Exact Mass | 511.07 |
| IUPAC Name | 1-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-3-(3-hydroxy-2-phenylpropyl)-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(/NCc1ccc(F)cc1C(F)(F)F)NCC(CO)c1ccccc1.I |
| InChI | InChI=1S/C19H21F4N3O.HI/c1-24-18(26-11-15(12-27)13-5-3-2-4-6-13)25-10-14-7-8-16(20)9-17(14)19(21,22)23;/h2-9,15,27H,10-12H2,1H3,(H2,24,25,26);1H |
| InChIKey | VFBIBPLBWHTOJX-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.30 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|