C15H15F4N3S — CID 111258585
1-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-2-methyl-3-(thiophen-2-ylmethyl)guanidine (PubChem CID 111258585) has the molecular formula C15H15F4N3S and a molecular weight of 345.37 g/mol. Its IUPAC name is 1-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-2-methyl-3-(thiophen-2-ylmethyl)guanidine.
| Compound Name | 1-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-2-methyl-3-(thiophen-2-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111258585 |
| Molecular Formula | C15H15F4N3S |
| Molecular Weight | 345.37 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | 1-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-2-methyl-3-(thiophen-2-ylmethyl)guanidine |
| SMILES | C/N=C(\NCc1cccs1)NCc1ccc(F)cc1C(F)(F)F |
| InChI | InChI=1S/C15H15F4N3S/c1-20-14(22-9-12-3-2-6-23-12)21-8-10-4-5-11(16)7-13(10)15(17,18)19/h2-7H,8-9H2,1H3,(H2,20,21,22) |
| InChIKey | HLKVJFPCCTUDHM-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.37 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|