C19H21F4N3O2S — CID 111889573
1-[3-(benzenesulfonyl)propyl]-3-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-2-methylguanidine (PubChem CID 111889573) has the molecular formula C19H21F4N3O2S and a molecular weight of 431.46 g/mol. Its IUPAC name is 1-[3-(benzenesulfonyl)propyl]-3-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-2-methylguanidine.
| Compound Name | 1-[3-(benzenesulfonyl)propyl]-3-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111889573 |
| Molecular Formula | C19H21F4N3O2S |
| Molecular Weight | 431.46 g/mol |
| Exact Mass | 431.13 |
| IUPAC Name | 1-[3-(benzenesulfonyl)propyl]-3-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-2-methylguanidine |
| SMILES | C/N=C(\NCCCS(=O)(=O)c1ccccc1)NCc1ccc(F)cc1C(F)(F)F |
| InChI | InChI=1S/C19H21F4N3O2S/c1-24-18(25-10-5-11-29(27,28)16-6-3-2-4-7-16)26-13-14-8-9-15(20)12-17(14)19(21,22)23/h2-4,6-9,12H,5,10-11,13H2,1H3,(H2,24,25,26) |
| InChIKey | SBFNUHQDVPFEOC-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.46 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|