C17H25F4N3O2 — CID 111890195
1-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-3-[4-(2-methoxyethoxy)butyl]-2-methylguanidine (PubChem CID 111890195) has the molecular formula C17H25F4N3O2 and a molecular weight of 379.40 g/mol. Its IUPAC name is 1-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-3-[4-(2-methoxyethoxy)butyl]-2-methylguanidine.
| Compound Name | 1-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-3-[4-(2-methoxyethoxy)butyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111890195 |
| Molecular Formula | C17H25F4N3O2 |
| Molecular Weight | 379.40 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | 1-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-3-[4-(2-methoxyethoxy)butyl]-2-methylguanidine |
| SMILES | C/N=C(\NCCCCOCCOC)NCc1ccc(F)cc1C(F)(F)F |
| InChI | InChI=1S/C17H25F4N3O2/c1-22-16(23-7-3-4-8-26-10-9-25-2)24-12-13-5-6-14(18)11-15(13)17(19,20)21/h5-6,11H,3-4,7-10,12H2,1-2H3,(H2,22,23,24) |
| InChIKey | RSBSKBFBZCTBKZ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.40 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|