C19H27F4N3O2 — CID 111642286
1-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-2-methyl-3-[3-(oxan-4-ylmethoxy)propyl]guanidine (PubChem CID 111642286) has the molecular formula C19H27F4N3O2 and a molecular weight of 405.44 g/mol. Its IUPAC name is 1-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-2-methyl-3-[3-(oxan-4-ylmethoxy)propyl]guanidine.
| Compound Name | 1-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-2-methyl-3-[3-(oxan-4-ylmethoxy)propyl]guanidine |
|---|---|
| PubChem CID | 111642286 |
| Molecular Formula | C19H27F4N3O2 |
| Molecular Weight | 405.44 g/mol |
| Exact Mass | 405.20 |
| IUPAC Name | 1-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-2-methyl-3-[3-(oxan-4-ylmethoxy)propyl]guanidine |
| SMILES | C/N=C(\NCCCOCC1CCOCC1)NCc1ccc(F)cc1C(F)(F)F |
| InChI | InChI=1S/C19H27F4N3O2/c1-24-18(25-7-2-8-28-13-14-5-9-27-10-6-14)26-12-15-3-4-16(20)11-17(15)19(21,22)23/h3-4,11,14H,2,5-10,12-13H2,1H3,(H2,24,25,26) |
| InChIKey | HBAGWUYBGFXFFO-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.44 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|