C18H22F2IN3O2S — CID 111902140
1-[3-(benzenesulfonyl)propyl]-3-[(2,5-difluorophenyl)methyl]-2-methylguanidine;hydroiodide (PubChem CID 111902140) has the molecular formula C18H22F2IN3O2S and a molecular weight of 509.36 g/mol. Its IUPAC name is 1-[3-(benzenesulfonyl)propyl]-3-[(2,5-difluorophenyl)methyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[3-(benzenesulfonyl)propyl]-3-[(2,5-difluorophenyl)methyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111902140 |
| Molecular Formula | C18H22F2IN3O2S |
| Molecular Weight | 509.36 g/mol |
| Exact Mass | 509.04 |
| IUPAC Name | 1-[3-(benzenesulfonyl)propyl]-3-[(2,5-difluorophenyl)methyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCCCS(=O)(=O)c1ccccc1)NCc1cc(F)ccc1F.I |
| InChI | InChI=1S/C18H21F2N3O2S.HI/c1-21-18(23-13-14-12-15(19)8-9-17(14)20)22-10-5-11-26(24,25)16-6-3-2-4-7-16;/h2-4,6-9,12H,5,10-11,13H2,1H3,(H2,21,22,23);1H |
| InChIKey | WELFBWWZWBKLHW-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.36 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|