C17H21F2IN4O2S — CID 111902108
1-[(2,5-difluorophenyl)methyl]-2-methyl-3-[2-(4-sulfamoylphenyl)ethyl]guanidine;hydroiodide (PubChem CID 111902108) has the molecular formula C17H21F2IN4O2S and a molecular weight of 510.35 g/mol. Its IUPAC name is 1-[(2,5-difluorophenyl)methyl]-2-methyl-3-[2-(4-sulfamoylphenyl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-[(2,5-difluorophenyl)methyl]-2-methyl-3-[2-(4-sulfamoylphenyl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111902108 |
| Molecular Formula | C17H21F2IN4O2S |
| Molecular Weight | 510.35 g/mol |
| Exact Mass | 510.04 |
| IUPAC Name | 1-[(2,5-difluorophenyl)methyl]-2-methyl-3-[2-(4-sulfamoylphenyl)ethyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCc1ccc(S(N)(=O)=O)cc1)NCc1cc(F)ccc1F.I |
| InChI | InChI=1S/C17H20F2N4O2S.HI/c1-21-17(23-11-13-10-14(18)4-7-16(13)19)22-9-8-12-2-5-15(6-3-12)26(20,24)25;/h2-7,10H,8-9,11H2,1H3,(H2,20,24,25)(H2,21,22,23);1H |
| InChIKey | QENVRDFRCVEEFJ-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 96.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.35 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|