C18H22F3IN4O3S — CID 111848010
2-methyl-1-[2-(4-sulfamoylphenyl)ethyl]-3-[[2-(trifluoromethoxy)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111848010) has the molecular formula C18H22F3IN4O3S and a molecular weight of 558.36 g/mol. Its IUPAC name is 2-methyl-1-[2-(4-sulfamoylphenyl)ethyl]-3-[[2-(trifluoromethoxy)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[2-(4-sulfamoylphenyl)ethyl]-3-[[2-(trifluoromethoxy)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111848010 |
| Molecular Formula | C18H22F3IN4O3S |
| Molecular Weight | 558.36 g/mol |
| Exact Mass | 558.04 |
| IUPAC Name | 2-methyl-1-[2-(4-sulfamoylphenyl)ethyl]-3-[[2-(trifluoromethoxy)phenyl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCc1ccc(S(N)(=O)=O)cc1)NCc1ccccc1OC(F)(F)F.I |
| InChI | InChI=1S/C18H21F3N4O3S.HI/c1-23-17(24-11-10-13-6-8-15(9-7-13)29(22,26)27)25-12-14-4-2-3-5-16(14)28-18(19,20)21;/h2-9H,10-12H2,1H3,(H2,22,26,27)(H2,23,24,25);1H |
| InChIKey | JNDKNHYDKYGEIS-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 105.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.36 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|