C13H19F3N4O3S — CID 111848151
1-[2-(methanesulfonamido)ethyl]-2-methyl-3-[[2-(trifluoromethoxy)phenyl]methyl]guanidine (PubChem CID 111848151) has the molecular formula C13H19F3N4O3S and a molecular weight of 368.38 g/mol. Its IUPAC name is 1-[2-(methanesulfonamido)ethyl]-2-methyl-3-[[2-(trifluoromethoxy)phenyl]methyl]guanidine.
| Compound Name | 1-[2-(methanesulfonamido)ethyl]-2-methyl-3-[[2-(trifluoromethoxy)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111848151 |
| Molecular Formula | C13H19F3N4O3S |
| Molecular Weight | 368.38 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | 1-[2-(methanesulfonamido)ethyl]-2-methyl-3-[[2-(trifluoromethoxy)phenyl]methyl]guanidine |
| SMILES | C/N=C(\NCCNS(C)(=O)=O)NCc1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C13H19F3N4O3S/c1-17-12(18-7-8-20-24(2,21)22)19-9-10-5-3-4-6-11(10)23-13(14,15)16/h3-6,20H,7-9H2,1-2H3,(H2,17,18,19) |
| InChIKey | XDJHXVFOBRJSFB-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 91.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.38 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|