C14H19F3IN3O3 — CID 111847884
methyl 3-[[N'-methyl-N-[[2-(trifluoromethoxy)phenyl]methyl]carbamimidoyl]amino]propanoate;hydroiodide (PubChem CID 111847884) has the molecular formula C14H19F3IN3O3 and a molecular weight of 461.22 g/mol. Its IUPAC name is methyl 3-[[N'-methyl-N-[[2-(trifluoromethoxy)phenyl]methyl]carbamimidoyl]amino]propanoate;hydroiodide.
| Compound Name | methyl 3-[[N'-methyl-N-[[2-(trifluoromethoxy)phenyl]methyl]carbamimidoyl]amino]propanoate;hydroiodide |
|---|---|
| PubChem CID | 111847884 |
| Molecular Formula | C14H19F3IN3O3 |
| Molecular Weight | 461.22 g/mol |
| Exact Mass | 461.04 |
| IUPAC Name | methyl 3-[[N'-methyl-N-[[2-(trifluoromethoxy)phenyl]methyl]carbamimidoyl]amino]propanoate;hydroiodide |
| SMILES | C/N=C(\NCCC(=O)OC)NCc1ccccc1OC(F)(F)F.I |
| InChI | InChI=1S/C14H18F3N3O3.HI/c1-18-13(19-8-7-12(21)22-2)20-9-10-5-3-4-6-11(10)23-14(15,16)17;/h3-6H,7-9H2,1-2H3,(H2,18,19,20);1H |
| InChIKey | IRWQLGCYDBZAIL-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.22 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|