C15H23F3IN3O2 — CID 111605598
1-(2-methoxy-2-methylpropyl)-2-methyl-3-[[2-(trifluoromethoxy)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111605598) has the molecular formula C15H23F3IN3O2 and a molecular weight of 461.27 g/mol. Its IUPAC name is 1-(2-methoxy-2-methylpropyl)-2-methyl-3-[[2-(trifluoromethoxy)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-(2-methoxy-2-methylpropyl)-2-methyl-3-[[2-(trifluoromethoxy)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111605598 |
| Molecular Formula | C15H23F3IN3O2 |
| Molecular Weight | 461.27 g/mol |
| Exact Mass | 461.08 |
| IUPAC Name | 1-(2-methoxy-2-methylpropyl)-2-methyl-3-[[2-(trifluoromethoxy)phenyl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1ccccc1OC(F)(F)F)NCC(C)(C)OC.I |
| InChI | InChI=1S/C15H22F3N3O2.HI/c1-14(2,22-4)10-21-13(19-3)20-9-11-7-5-6-8-12(11)23-15(16,17)18;/h5-8H,9-10H2,1-4H3,(H2,19,20,21);1H |
| InChIKey | WKQCRVSSTKOHCE-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.27 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|