C20H25F3IN3O4 — CID 111848294
2-methyl-1-[[2-(trifluoromethoxy)phenyl]methyl]-3-[(2,3,4-trimethoxyphenyl)methyl]guanidine;hydroiodide (PubChem CID 111848294) has the molecular formula C20H25F3IN3O4 and a molecular weight of 555.34 g/mol. Its IUPAC name is 2-methyl-1-[[2-(trifluoromethoxy)phenyl]methyl]-3-[(2,3,4-trimethoxyphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[[2-(trifluoromethoxy)phenyl]methyl]-3-[(2,3,4-trimethoxyphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111848294 |
| Molecular Formula | C20H25F3IN3O4 |
| Molecular Weight | 555.34 g/mol |
| Exact Mass | 555.08 |
| IUPAC Name | 2-methyl-1-[[2-(trifluoromethoxy)phenyl]methyl]-3-[(2,3,4-trimethoxyphenyl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1ccccc1OC(F)(F)F)NCc1ccc(OC)c(OC)c1OC.I |
| InChI | InChI=1S/C20H24F3N3O4.HI/c1-24-19(25-11-13-7-5-6-8-15(13)30-20(21,22)23)26-12-14-9-10-16(27-2)18(29-4)17(14)28-3;/h5-10H,11-12H2,1-4H3,(H2,24,25,26);1H |
| InChIKey | HDXDHEVXPWZXSD-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.34 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|