C19H20Cl2N2O — CID 46098139
2-cyclopent-2-en-1-yl-N-(5,7-dichloro-2,3,4,9-tetrahydro-1H-carbazol-3-yl)acetamide (PubChem CID 46098139) has the molecular formula C19H20Cl2N2O and a molecular weight of 363.29 g/mol. Its IUPAC name is 2-cyclopent-2-en-1-yl-N-(5,7-dichloro-2,3,4,9-tetrahydro-1H-carbazol-3-yl)acetamide.
| Compound Name | 2-cyclopent-2-en-1-yl-N-(5,7-dichloro-2,3,4,9-tetrahydro-1H-carbazol-3-yl)acetamide |
|---|---|
| PubChem CID | 46098139 |
| Molecular Formula | C19H20Cl2N2O |
| Molecular Weight | 363.29 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | 2-cyclopent-2-en-1-yl-N-(5,7-dichloro-2,3,4,9-tetrahydro-1H-carbazol-3-yl)acetamide |
| SMILES | O=C(CC1C=CCC1)NC1CCc2[nH]c3cc(Cl)cc(Cl)c3c2C1 |
| InChI | InChI=1S/C19H20Cl2N2O/c20-12-8-15(21)19-14-10-13(5-6-16(14)23-17(19)9-12)22-18(24)7-11-3-1-2-4-11/h1,3,8-9,11,13,23H,2,4-7,10H2,(H,22,24) |
| InChIKey | HLWZRJMETXVYSG-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.29 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|