C17H20Cl2N2O — CID 72694224
4,6-dichloro-N-(4,4-dimethylcyclohexyl)-1H-indole-2-carboxamide (PubChem CID 72694224) has the molecular formula C17H20Cl2N2O and a molecular weight of 339.27 g/mol. Its IUPAC name is 4,6-dichloro-N-(4,4-dimethylcyclohexyl)-1H-indole-2-carboxamide.
| Compound Name | 4,6-dichloro-N-(4,4-dimethylcyclohexyl)-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 72694224 |
| Molecular Formula | C17H20Cl2N2O |
| Molecular Weight | 339.27 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | 4,6-dichloro-N-(4,4-dimethylcyclohexyl)-1H-indole-2-carboxamide |
| SMILES | CC1(C)CCC(NC(=O)c2cc3c(Cl)cc(Cl)cc3[nH]2)CC1 |
| InChI | InChI=1S/C17H20Cl2N2O/c1-17(2)5-3-11(4-6-17)20-16(22)15-9-12-13(19)7-10(18)8-14(12)21-15/h7-9,11,21H,3-6H2,1-2H3,(H,20,22) |
| InChIKey | NKNGAORFGPSYJG-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.27 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |