C12H14Cl3N3O3S — CID 60547157
2-(1,1-dioxo-1,4-thiazinan-4-yl)-N'-(2,4,6-trichlorophenyl)acetohydrazide (PubChem CID 60547157) has the molecular formula C12H14Cl3N3O3S and a molecular weight of 386.69 g/mol. Its IUPAC name is 2-(1,1-dioxo-1,4-thiazinan-4-yl)-N'-(2,4,6-trichlorophenyl)acetohydrazide.
| Compound Name | 2-(1,1-dioxo-1,4-thiazinan-4-yl)-N'-(2,4,6-trichlorophenyl)acetohydrazide |
|---|---|
| PubChem CID | 60547157 |
| Molecular Formula | C12H14Cl3N3O3S |
| Molecular Weight | 386.69 g/mol |
| Exact Mass | 384.98 |
| IUPAC Name | 2-(1,1-dioxo-1,4-thiazinan-4-yl)-N'-(2,4,6-trichlorophenyl)acetohydrazide |
| SMILES | O=C(CN1CCS(=O)(=O)CC1)NNc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C12H14Cl3N3O3S/c13-8-5-9(14)12(10(15)6-8)17-16-11(19)7-18-1-3-22(20,21)4-2-18/h5-6,17H,1-4,7H2,(H,16,19) |
| InChIKey | OUDPSCORLDRAPK-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.69 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|