C15H21ClN2O5S — CID 47081676
N-[3-chloro-2-(2-methoxyethoxy)phenyl]-2-(1,1-dioxo-1,4-thiazinan-4-yl)acetamide (PubChem CID 47081676) has the molecular formula C15H21ClN2O5S and a molecular weight of 376.86 g/mol. Its IUPAC name is N-[3-chloro-2-(2-methoxyethoxy)phenyl]-2-(1,1-dioxo-1,4-thiazinan-4-yl)acetamide.
| Compound Name | N-[3-chloro-2-(2-methoxyethoxy)phenyl]-2-(1,1-dioxo-1,4-thiazinan-4-yl)acetamide |
|---|---|
| PubChem CID | 47081676 |
| Molecular Formula | C15H21ClN2O5S |
| Molecular Weight | 376.86 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | N-[3-chloro-2-(2-methoxyethoxy)phenyl]-2-(1,1-dioxo-1,4-thiazinan-4-yl)acetamide |
| SMILES | COCCOc1c(Cl)cccc1NC(=O)CN1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C15H21ClN2O5S/c1-22-7-8-23-15-12(16)3-2-4-13(15)17-14(19)11-18-5-9-24(20,21)10-6-18/h2-4H,5-11H2,1H3,(H,17,19) |
| InChIKey | WMJGFMZIALWDPF-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.86 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|