C11H13Cl2NO3S — CID 82977282
2,4-dichloro-6-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]phenol (PubChem CID 82977282) has the molecular formula C11H13Cl2NO3S and a molecular weight of 310.20 g/mol. Its IUPAC name is 2,4-dichloro-6-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]phenol.
| Compound Name | 2,4-dichloro-6-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]phenol |
|---|---|
| PubChem CID | 82977282 |
| Molecular Formula | C11H13Cl2NO3S |
| Molecular Weight | 310.20 g/mol |
| Exact Mass | 309.00 |
| IUPAC Name | 2,4-dichloro-6-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]phenol |
| SMILES | O=S1(=O)CCN(Cc2cc(Cl)cc(Cl)c2O)CC1 |
| InChI | InChI=1S/C11H13Cl2NO3S/c12-9-5-8(11(15)10(13)6-9)7-14-1-3-18(16,17)4-2-14/h5-6,15H,1-4,7H2 |
| InChIKey | XWLCYRHVXGGQQQ-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.20 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|