C11H11Cl2NO3 — CID 65072097
1-[(3,5-dichloro-2-hydroxyphenyl)methyl]azetidine-3-carboxylic acid (PubChem CID 65072097) has the molecular formula C11H11Cl2NO3 and a molecular weight of 276.12 g/mol. Its IUPAC name is 1-[(3,5-dichloro-2-hydroxyphenyl)methyl]azetidine-3-carboxylic acid.
| Compound Name | 1-[(3,5-dichloro-2-hydroxyphenyl)methyl]azetidine-3-carboxylic acid |
|---|---|
| PubChem CID | 65072097 |
| Molecular Formula | C11H11Cl2NO3 |
| Molecular Weight | 276.12 g/mol |
| Exact Mass | 275.01 |
| IUPAC Name | 1-[(3,5-dichloro-2-hydroxyphenyl)methyl]azetidine-3-carboxylic acid |
| SMILES | O=C(O)C1CN(Cc2cc(Cl)cc(Cl)c2O)C1 |
| InChI | InChI=1S/C11H11Cl2NO3/c12-8-1-6(10(15)9(13)2-8)3-14-4-7(5-14)11(16)17/h1-2,7,15H,3-5H2,(H,16,17) |
| InChIKey | IKARMIMEOHIDIY-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.12 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|