C12H16Cl2N2O — CID 29009288
2-[(4-aminopiperidin-1-yl)methyl]-4,6-dichlorophenol (PubChem CID 29009288) has the molecular formula C12H16Cl2N2O and a molecular weight of 275.18 g/mol. Its IUPAC name is 2-[(4-aminopiperidin-1-yl)methyl]-4,6-dichlorophenol.
| Compound Name | 2-[(4-aminopiperidin-1-yl)methyl]-4,6-dichlorophenol |
|---|---|
| PubChem CID | 29009288 |
| Molecular Formula | C12H16Cl2N2O |
| Molecular Weight | 275.18 g/mol |
| Exact Mass | 274.06 |
| IUPAC Name | 2-[(4-aminopiperidin-1-yl)methyl]-4,6-dichlorophenol |
| SMILES | NC1CCN(Cc2cc(Cl)cc(Cl)c2O)CC1 |
| InChI | InChI=1S/C12H16Cl2N2O/c13-9-5-8(12(17)11(14)6-9)7-16-3-1-10(15)2-4-16/h5-6,10,17H,1-4,7,15H2 |
| InChIKey | IXNZUGCNMKHYGH-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.18 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|