C16H23Cl2NO — CID 82986743
2-[(4-tert-butylpiperidin-1-yl)methyl]-4,6-dichlorophenol (PubChem CID 82986743) has the molecular formula C16H23Cl2NO and a molecular weight of 316.27 g/mol. Its IUPAC name is 2-[(4-tert-butylpiperidin-1-yl)methyl]-4,6-dichlorophenol.
| Compound Name | 2-[(4-tert-butylpiperidin-1-yl)methyl]-4,6-dichlorophenol |
|---|---|
| PubChem CID | 82986743 |
| Molecular Formula | C16H23Cl2NO |
| Molecular Weight | 316.27 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | 2-[(4-tert-butylpiperidin-1-yl)methyl]-4,6-dichlorophenol |
| SMILES | CC(C)(C)C1CCN(Cc2cc(Cl)cc(Cl)c2O)CC1 |
| InChI | InChI=1S/C16H23Cl2NO/c1-16(2,3)12-4-6-19(7-5-12)10-11-8-13(17)9-14(18)15(11)20/h8-9,12,20H,4-7,10H2,1-3H3 |
| InChIKey | QXHZCEGPILZAON-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.27 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|