C16H20Cl2N4O — CID 50968839
2,4-dichloro-6-[[4-[(4-methyl-1,2,4-triazol-3-yl)methyl]piperidin-1-yl]methyl]phenol (PubChem CID 50968839) has the molecular formula C16H20Cl2N4O and a molecular weight of 355.27 g/mol. Its IUPAC name is 2,4-dichloro-6-[[4-[(4-methyl-1,2,4-triazol-3-yl)methyl]piperidin-1-yl]methyl]phenol.
| Compound Name | 2,4-dichloro-6-[[4-[(4-methyl-1,2,4-triazol-3-yl)methyl]piperidin-1-yl]methyl]phenol |
|---|---|
| PubChem CID | 50968839 |
| Molecular Formula | C16H20Cl2N4O |
| Molecular Weight | 355.27 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | 2,4-dichloro-6-[[4-[(4-methyl-1,2,4-triazol-3-yl)methyl]piperidin-1-yl]methyl]phenol |
| SMILES | Cn1cnnc1CC1CCN(Cc2cc(Cl)cc(Cl)c2O)CC1 |
| InChI | InChI=1S/C16H20Cl2N4O/c1-21-10-19-20-15(21)6-11-2-4-22(5-3-11)9-12-7-13(17)8-14(18)16(12)23/h7-8,10-11,23H,2-6,9H2,1H3 |
| InChIKey | YMJPNZAYHHKBLV-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.27 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|