C16H22N4 — CID 136580193
4-benzyl-1-[(4-methyl-1,2,4-triazol-3-yl)methyl]piperidine (PubChem CID 136580193) has the molecular formula C16H22N4 and a molecular weight of 270.38 g/mol. Its IUPAC name is 4-benzyl-1-[(4-methyl-1,2,4-triazol-3-yl)methyl]piperidine.
| Compound Name | 4-benzyl-1-[(4-methyl-1,2,4-triazol-3-yl)methyl]piperidine |
|---|---|
| PubChem CID | 136580193 |
| Molecular Formula | C16H22N4 |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | 4-benzyl-1-[(4-methyl-1,2,4-triazol-3-yl)methyl]piperidine |
| SMILES | Cn1cnnc1CN1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C16H22N4/c1-19-13-17-18-16(19)12-20-9-7-15(8-10-20)11-14-5-3-2-4-6-14/h2-6,13,15H,7-12H2,1H3 |
| InChIKey | UZDJMWABBKVXAP-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |