C9H16N4O — CID 112733969
1-[(4-methyl-1,2,4-triazol-3-yl)methyl]piperidin-4-ol (PubChem CID 112733969) has the molecular formula C9H16N4O and a molecular weight of 196.25 g/mol. Its IUPAC name is 1-[(4-methyl-1,2,4-triazol-3-yl)methyl]piperidin-4-ol.
| Compound Name | 1-[(4-methyl-1,2,4-triazol-3-yl)methyl]piperidin-4-ol |
|---|---|
| PubChem CID | 112733969 |
| Molecular Formula | C9H16N4O |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.13 |
| IUPAC Name | 1-[(4-methyl-1,2,4-triazol-3-yl)methyl]piperidin-4-ol |
| SMILES | Cn1cnnc1CN1CCC(O)CC1 |
| InChI | InChI=1S/C9H16N4O/c1-12-7-10-11-9(12)6-13-4-2-8(14)3-5-13/h7-8,14H,2-6H2,1H3 |
| InChIKey | CNFZBZFGBODZBZ-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |