C15H19Cl2NO4 — CID 167819970
2-[1-[(3,5-dichloro-2-hydroxyphenyl)methyl]piperidin-4-yl]-2-methoxyacetic acid (PubChem CID 167819970) has the molecular formula C15H19Cl2NO4 and a molecular weight of 348.23 g/mol. Its IUPAC name is 2-[1-[(3,5-dichloro-2-hydroxyphenyl)methyl]piperidin-4-yl]-2-methoxyacetic acid.
| Compound Name | 2-[1-[(3,5-dichloro-2-hydroxyphenyl)methyl]piperidin-4-yl]-2-methoxyacetic acid |
|---|---|
| PubChem CID | 167819970 |
| Molecular Formula | C15H19Cl2NO4 |
| Molecular Weight | 348.23 g/mol |
| Exact Mass | 347.07 |
| IUPAC Name | 2-[1-[(3,5-dichloro-2-hydroxyphenyl)methyl]piperidin-4-yl]-2-methoxyacetic acid |
| SMILES | COC(C(=O)O)C1CCN(Cc2cc(Cl)cc(Cl)c2O)CC1 |
| InChI | InChI=1S/C15H19Cl2NO4/c1-22-14(15(20)21)9-2-4-18(5-3-9)8-10-6-11(16)7-12(17)13(10)19/h6-7,9,14,19H,2-5,8H2,1H3,(H,20,21) |
| InChIKey | QAOWNIYJXBHYGQ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.23 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|