C14H20Cl2N2O — CID 54917129
2,4-dichloro-6-[[(1-ethylpiperidin-4-yl)amino]methyl]phenol (PubChem CID 54917129) has the molecular formula C14H20Cl2N2O and a molecular weight of 303.23 g/mol. Its IUPAC name is 2,4-dichloro-6-[[(1-ethylpiperidin-4-yl)amino]methyl]phenol.
| Compound Name | 2,4-dichloro-6-[[(1-ethylpiperidin-4-yl)amino]methyl]phenol |
|---|---|
| PubChem CID | 54917129 |
| Molecular Formula | C14H20Cl2N2O |
| Molecular Weight | 303.23 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | 2,4-dichloro-6-[[(1-ethylpiperidin-4-yl)amino]methyl]phenol |
| SMILES | CCN1CCC(NCc2cc(Cl)cc(Cl)c2O)CC1 |
| InChI | InChI=1S/C14H20Cl2N2O/c1-2-18-5-3-12(4-6-18)17-9-10-7-11(15)8-13(16)14(10)19/h7-8,12,17,19H,2-6,9H2,1H3 |
| InChIKey | WMIPSQCEOSGTLO-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.23 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|