C16H23ClFN3O2 — CID 146104505
2-[4-[(5-chloro-3-fluoro-2-hydroxyphenyl)methylamino]piperidin-1-yl]-N,N-dimethylacetamide (PubChem CID 146104505) has the molecular formula C16H23ClFN3O2 and a molecular weight of 343.83 g/mol. Its IUPAC name is 2-[4-[(5-chloro-3-fluoro-2-hydroxyphenyl)methylamino]piperidin-1-yl]-N,N-dimethylacetamide.
| Compound Name | 2-[4-[(5-chloro-3-fluoro-2-hydroxyphenyl)methylamino]piperidin-1-yl]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 146104505 |
| Molecular Formula | C16H23ClFN3O2 |
| Molecular Weight | 343.83 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | 2-[4-[(5-chloro-3-fluoro-2-hydroxyphenyl)methylamino]piperidin-1-yl]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)CN1CCC(NCc2cc(Cl)cc(F)c2O)CC1 |
| InChI | InChI=1S/C16H23ClFN3O2/c1-20(2)15(22)10-21-5-3-13(4-6-21)19-9-11-7-12(17)8-14(18)16(11)23/h7-8,13,19,23H,3-6,9-10H2,1-2H3 |
| InChIKey | KZYBPHGVWZYTCT-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.83 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|