C14H18F3N3O — CID 103792489
2-[4-[(2,4,5-trifluorophenyl)methylamino]piperidin-1-yl]acetamide (PubChem CID 103792489) has the molecular formula C14H18F3N3O and a molecular weight of 301.31 g/mol. Its IUPAC name is 2-[4-[(2,4,5-trifluorophenyl)methylamino]piperidin-1-yl]acetamide.
| Compound Name | 2-[4-[(2,4,5-trifluorophenyl)methylamino]piperidin-1-yl]acetamide |
|---|---|
| PubChem CID | 103792489 |
| Molecular Formula | C14H18F3N3O |
| Molecular Weight | 301.31 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | 2-[4-[(2,4,5-trifluorophenyl)methylamino]piperidin-1-yl]acetamide |
| SMILES | NC(=O)CN1CCC(NCc2cc(F)c(F)cc2F)CC1 |
| InChI | InChI=1S/C14H18F3N3O/c15-11-6-13(17)12(16)5-9(11)7-19-10-1-3-20(4-2-10)8-14(18)21/h5-6,10,19H,1-4,7-8H2,(H2,18,21) |
| InChIKey | KVLDGUULROAUAC-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.31 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|