C14H19ClFN3O — CID 115695785
2-[4-[(3-chloro-2-fluorophenyl)methylamino]piperidin-1-yl]acetamide (PubChem CID 115695785) has the molecular formula C14H19ClFN3O and a molecular weight of 299.78 g/mol. Its IUPAC name is 2-[4-[(3-chloro-2-fluorophenyl)methylamino]piperidin-1-yl]acetamide.
| Compound Name | 2-[4-[(3-chloro-2-fluorophenyl)methylamino]piperidin-1-yl]acetamide |
|---|---|
| PubChem CID | 115695785 |
| Molecular Formula | C14H19ClFN3O |
| Molecular Weight | 299.78 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 2-[4-[(3-chloro-2-fluorophenyl)methylamino]piperidin-1-yl]acetamide |
| SMILES | NC(=O)CN1CCC(NCc2cccc(Cl)c2F)CC1 |
| InChI | InChI=1S/C14H19ClFN3O/c15-12-3-1-2-10(14(12)16)8-18-11-4-6-19(7-5-11)9-13(17)20/h1-3,11,18H,4-9H2,(H2,17,20) |
| InChIKey | FWPIIEMMKANHQW-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.78 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |